C21H26N2O3 — CID 23885609
2-[4-(3,4-dimethoxyphenyl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 23885609) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 23885609 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | COc1ccc(C2=NC(C(C)C)NC(c3ccccc3O)C2)cc1OC |
| InChI | InChI=1S/C21H26N2O3/c1-13(2)21-22-16(14-9-10-19(25-3)20(11-14)26-4)12-17(23-21)15-7-5-6-8-18(15)24/h5-11,13,17,21,23-24H,12H2,1-4H3 |
| InChIKey | VFMYTZIUNYXPKQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|