C23H18FN3O2S — CID 23886561
N-(2-fluorophenyl)-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylpropanamide (PubChem CID 23886561) has the molecular formula C23H18FN3O2S and a molecular weight of 419.48 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylpropanamide.
| Compound Name | N-(2-fluorophenyl)-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 23886561 |
| Molecular Formula | C23H18FN3O2S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N-(2-fluorophenyl)-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylpropanamide |
| SMILES | CC(Sc1nc2ccccc2c(=O)n1-c1ccccc1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C23H18FN3O2S/c1-15(21(28)25-20-14-8-6-12-18(20)24)30-23-26-19-13-7-5-11-17(19)22(29)27(23)16-9-3-2-4-10-16/h2-15H,1H3,(H,25,28) |
| InChIKey | AWBJXOPJBPBGFJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |