C29H25Cl2NO2 — CID 23887196
4-(2,3-dichlorophenyl)-1-(2,3-dimethylphenyl)-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione (PubChem CID 23887196) has the molecular formula C29H25Cl2NO2 and a molecular weight of 490.43 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-1-(2,3-dimethylphenyl)-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione.
| Compound Name | 4-(2,3-dichlorophenyl)-1-(2,3-dimethylphenyl)-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 23887196 |
| Molecular Formula | C29H25Cl2NO2 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-1-(2,3-dimethylphenyl)-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
| SMILES | Cc1cccc(N2C(=O)CC(c3cccc(Cl)c3Cl)C3=C2CC(c2ccccc2)CC3=O)c1C |
| InChI | InChI=1S/C29H25Cl2NO2/c1-17-8-6-13-24(18(17)2)32-25-14-20(19-9-4-3-5-10-19)15-26(33)28(25)22(16-27(32)34)21-11-7-12-23(30)29(21)31/h3-13,20,22H,14-16H2,1-2H3 |
| InChIKey | CBLYXLVQQZTVAG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |