About [1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate
[1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate (PubChem CID 23888136) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is [1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate.
Molecular Properties
| Compound Name | [1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate |
| PubChem CID | 23888136 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate |
| SMILES | CCC(OC(=O)c1cccc(N)c1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H20N2O3/c1-2-17(24-19(23)14-7-5-8-15(20)12-14)18(22)21-11-10-13-6-3-4-9-16(13)21/h3-9,12,17H,2,10-11,20H2,1H3 |
| InChIKey | BZSPJBVYMJYGMW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate?
The IUPAC name of [1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate (CID 23888136) is [1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate.
What is the SMILES notation for [1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate?
The canonical SMILES for [1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate is CCC(OC(=O)c1cccc(N)c1)C(=O)N1CCc2ccccc21.
What is the InChIKey of [1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate?
The InChIKey is BZSPJBVYMJYGMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3/c1-2-17(24-19(23)14-7-5-8-15(20)12-14)18(22)21-11-10-13-6-3-4-9-16(13)21/h3-9,12,17H,2,10-11,20H2,1H3.
What are the key properties of [1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate?
[1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate has a molecular weight of 324.38 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dihydroindol-1-yl)-1-oxobutan-2-yl] 3-aminobenzoate is sourced from PubChem (CID 23888136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).