About [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate (PubChem CID 2388958) has the molecular formula C18H24N2O3
and a molecular weight of 316.40 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate.
Molecular Properties
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate |
| PubChem CID | 2388958 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NCCC2=CCCCC2)cc1N |
| InChI | InChI=1S/C18H24N2O3/c1-13-7-8-15(11-16(13)19)18(22)23-12-17(21)20-10-9-14-5-3-2-4-6-14/h5,7-8,11H,2-4,6,9-10,12,19H2,1H3,(H,20,21) |
| InChIKey | BKFXJTHYMOECED-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate?
The IUPAC name of [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate (CID 2388958) is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate.
What is the SMILES notation for [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate?
The canonical SMILES for [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate is Cc1ccc(C(=O)OCC(=O)NCCC2=CCCCC2)cc1N.
What is the InChIKey of [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate?
The InChIKey is BKFXJTHYMOECED-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O3/c1-13-7-8-15(11-16(13)19)18(22)23-12-17(21)20-10-9-14-5-3-2-4-6-14/h5,7-8,11H,2-4,6,9-10,12,19H2,1H3,(H,20,21).
What are the key properties of [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate?
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate has a molecular weight of 316.40 g/mol, XLogP of 2.74, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-amino-4-methylbenzoate is sourced from PubChem (CID 2388958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).