About (2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone
(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone (PubChem CID 23889651) has the molecular formula C25H25NO2
and a molecular weight of 371.48 g/mol. Its IUPAC name is (2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone.
Molecular Properties
| Compound Name | (2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone |
| PubChem CID | 23889651 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2c3ccc(C)cc3C(c3ccccc3)CC2C)cc1 |
| InChI | InChI=1S/C25H25NO2/c1-17-9-14-24-23(15-17)22(19-7-5-4-6-8-19)16-18(2)26(24)25(27)20-10-12-21(28-3)13-11-20/h4-15,18,22H,16H2,1-3H3 |
| InChIKey | UUICANXJKLKETI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone?
The IUPAC name of (2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone (CID 23889651) is (2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone.
What is the SMILES notation for (2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone?
The canonical SMILES for (2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone is COc1ccc(C(=O)N2c3ccc(C)cc3C(c3ccccc3)CC2C)cc1.
What is the InChIKey of (2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone?
The InChIKey is UUICANXJKLKETI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO2/c1-17-9-14-24-23(15-17)22(19-7-5-4-6-8-19)16-18(2)26(24)25(27)20-10-12-21(28-3)13-11-20/h4-15,18,22H,16H2,1-3H3.
What are the key properties of (2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone?
(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone has a molecular weight of 371.48 g/mol, XLogP of 5.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)-(4-methoxyphenyl)methanone is sourced from PubChem (CID 23889651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).