C23H25BrO4 — CID 23889816
(2Z,7Z)-8-(5-bromo-2-hydroxyphenyl)-3-(3-hydroxyprop-1-en-2-yl)-7-phenylocta-2,7-diene-1,4-diol (PubChem CID 23889816) has the molecular formula C23H25BrO4 and a molecular weight of 445.35 g/mol. Its IUPAC name is (2Z,7Z)-8-(5-bromo-2-hydroxyphenyl)-3-(3-hydroxyprop-1-en-2-yl)-7-phenylocta-2,7-diene-1,4-diol.
| Compound Name | (2Z,7Z)-8-(5-bromo-2-hydroxyphenyl)-3-(3-hydroxyprop-1-en-2-yl)-7-phenylocta-2,7-diene-1,4-diol |
|---|---|
| PubChem CID | 23889816 |
| Molecular Formula | C23H25BrO4 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | (2Z,7Z)-8-(5-bromo-2-hydroxyphenyl)-3-(3-hydroxyprop-1-en-2-yl)-7-phenylocta-2,7-diene-1,4-diol |
| SMILES | C=C(CO)/C(=C/CO)C(O)CC/C(=C/c1cc(Br)ccc1O)c1ccccc1 |
| InChI | InChI=1S/C23H25BrO4/c1-16(15-26)21(11-12-25)23(28)9-7-18(17-5-3-2-4-6-17)13-19-14-20(24)8-10-22(19)27/h2-6,8,10-11,13-14,23,25-28H,1,7,9,12,15H2/b18-13-,21-11- |
| InChIKey | ZMUMEBPYLPPOFY-GWRIMKFOSA-N |
| XLogP | 4.30 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|