C24H26BIO7S — CID 23889855
4-[(Z)-4-[(4R,7aS)-6-hydroxy-3-(hydroxymethyl)-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2-iodo-6-methoxyphenol (PubChem CID 23889855) has the molecular formula C24H26BIO7S and a molecular weight of 596.25 g/mol. Its IUPAC name is 4-[(Z)-4-[(4R,7aS)-6-hydroxy-3-(hydroxymethyl)-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2-iodo-6-methoxyphenol.
| Compound Name | 4-[(Z)-4-[(4R,7aS)-6-hydroxy-3-(hydroxymethyl)-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2-iodo-6-methoxyphenol |
|---|---|
| PubChem CID | 23889855 |
| Molecular Formula | C24H26BIO7S |
| Molecular Weight | 596.25 g/mol |
| Exact Mass | 596.05 |
| IUPAC Name | 4-[(Z)-4-[(4R,7aS)-6-hydroxy-3-(hydroxymethyl)-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2-iodo-6-methoxyphenol |
| SMILES | COc1cc(/C=C(/CC[C@H]2OB(O)C[C@H]3C2=C(CO)CS3(=O)=O)c2ccccc2)cc(I)c1O |
| InChI | InChI=1S/C24H26BIO7S/c1-32-21-11-15(10-19(26)24(21)28)9-17(16-5-3-2-4-6-16)7-8-20-23-18(13-27)14-34(30,31)22(23)12-25(29)33-20/h2-6,9-11,20,22,27-29H,7-8,12-14H2,1H3/b17-9-/t20-,22+/m1/s1 |
| InChIKey | UWTBIMXRVMDNFT-KELKIYKKSA-N |
| XLogP | 3.29 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|