C25H26O3S — CID 23890819
(Z,1S,2R,3R)-2-ethenyl-7-(2-hydroxyphenyl)-6-phenyl-1-thiophen-2-ylhept-6-ene-1,3-diol (PubChem CID 23890819) has the molecular formula C25H26O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is (Z,1S,2R,3R)-2-ethenyl-7-(2-hydroxyphenyl)-6-phenyl-1-thiophen-2-ylhept-6-ene-1,3-diol.
| Compound Name | (Z,1S,2R,3R)-2-ethenyl-7-(2-hydroxyphenyl)-6-phenyl-1-thiophen-2-ylhept-6-ene-1,3-diol |
|---|---|
| PubChem CID | 23890819 |
| Molecular Formula | C25H26O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (Z,1S,2R,3R)-2-ethenyl-7-(2-hydroxyphenyl)-6-phenyl-1-thiophen-2-ylhept-6-ene-1,3-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1ccccc1O)c1ccccc1)[C@H](O)c1cccs1 |
| InChI | InChI=1S/C25H26O3S/c1-2-21(25(28)24-13-8-16-29-24)23(27)15-14-19(18-9-4-3-5-10-18)17-20-11-6-7-12-22(20)26/h2-13,16-17,21,23,25-28H,1,14-15H2/b19-17-/t21-,23-,25+/m1/s1 |
| InChIKey | KDBTYWRRLZFHQX-KYLKALFVSA-N |
| XLogP | 5.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|