About 4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride
4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride (PubChem CID 23892) has the molecular formula C12H18Cl4N4
and a molecular weight of 360.12 g/mol. Its IUPAC name is 4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride.
Molecular Properties
| Compound Name | 4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride |
| PubChem CID | 23892 |
| Molecular Formula | C12H18Cl4N4 |
| Molecular Weight | 360.12 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.Nc1ccc(-c2ccc(N)c(N)c2)cc1N |
| InChI | InChI=1S/C12H14N4.4ClH/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8;;;;/h1-6H,13-16H2;4*1H |
| InChIKey | KJDSORYAHBAGPP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride?
The IUPAC name of 4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride (CID 23892) is 4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride.
What is the SMILES notation for 4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride?
The canonical SMILES for 4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride is Cl.Cl.Cl.Cl.Nc1ccc(-c2ccc(N)c(N)c2)cc1N.
What is the InChIKey of 4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride?
The InChIKey is KJDSORYAHBAGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4.4ClH/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8;;;;/h1-6H,13-16H2;4*1H.
What are the key properties of 4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride?
4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride has a molecular weight of 360.12 g/mol, XLogP of 3.37, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-diaminophenyl)benzene-1,2-diamine;tetrahydrochloride is sourced from PubChem (CID 23892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).