C15H15N3O2 — CID 2389332
ethyl 1-(2-cyanoethyl)-3-phenylpyrazole-5-carboxylate (PubChem CID 2389332) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is ethyl 1-(2-cyanoethyl)-3-phenylpyrazole-5-carboxylate.
| Compound Name | ethyl 1-(2-cyanoethyl)-3-phenylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 2389332 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | ethyl 1-(2-cyanoethyl)-3-phenylpyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)nn1CCC#N |
| InChI | InChI=1S/C15H15N3O2/c1-2-20-15(19)14-11-13(12-7-4-3-5-8-12)17-18(14)10-6-9-16/h3-5,7-8,11H,2,6,10H2,1H3 |
| InChIKey | OWGJKKLMVHBULX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |