C32H44N2O5S — CID 23895508
hex-5-enyl (5S,6S,7R)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23895508) has the molecular formula C32H44N2O5S and a molecular weight of 568.78 g/mol. Its IUPAC name is hex-5-enyl (5S,6S,7R)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5S,6S,7R)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23895508 |
| Molecular Formula | C32H44N2O5S |
| Molecular Weight | 568.78 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | hex-5-enyl (5S,6S,7R)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)C(C)C)C(C(=O)N(CC=C)c3c(C)cccc3C)C23CC[C@H]1S3 |
| InChI | InChI=1S/C32H44N2O5S/c1-7-9-10-11-18-39-31(38)25-24-15-16-32(40-24)26(25)29(36)34(23(19-35)20(3)4)28(32)30(37)33(17-8-2)27-21(5)13-12-14-22(27)6/h7-8,12-14,20,23-26,28,35H,1-2,9-11,15-19H2,3-6H3/t23-,24+,25-,26-,28?,32?/m0/s1 |
| InChIKey | AAYYZMWRTXIAPX-MUNRHRQCSA-N |
| XLogP | 4.83 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.78 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|