C9H9ClN6OS — CID 2389900
2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 2389900) has the molecular formula C9H9ClN6OS and a molecular weight of 284.73 g/mol. Its IUPAC name is 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 2389900 |
| Molecular Formula | C9H9ClN6OS |
| Molecular Weight | 284.73 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | Nc1nc(SCC(=O)Nc2cccnc2Cl)n[nH]1 |
| InChI | InChI=1S/C9H9ClN6OS/c10-7-5(2-1-3-12-7)13-6(17)4-18-9-14-8(11)15-16-9/h1-3H,4H2,(H,13,17)(H3,11,14,15,16) |
| InChIKey | HJXXTJRQLMTFDB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.73 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|