C38H53N3O7 — CID 23899819
[(1R)-2-(pent-4-enoylamino)-1-phenylethyl] (1S,2S,5R,6R,7R)-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23899819) has the molecular formula C38H53N3O7 and a molecular weight of 663.86 g/mol. Its IUPAC name is [(1R)-2-(pent-4-enoylamino)-1-phenylethyl] (1S,2S,5R,6R,7R)-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | [(1R)-2-(pent-4-enoylamino)-1-phenylethyl] (1S,2S,5R,6R,7R)-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23899819 |
| Molecular Formula | C38H53N3O7 |
| Molecular Weight | 663.86 g/mol |
| Exact Mass | 663.39 |
| IUPAC Name | [(1R)-2-(pent-4-enoylamino)-1-phenylethyl] (1S,2S,5R,6R,7R)-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCC(=O)NC[C@H](OC(=O)[C@@H]1[C@H]2C(=O)N(CCCCCCO)[C@H](C(=O)N(CC=C)C3CCCCC3)[C@]23CC[C@H]1O3)c1ccccc1 |
| InChI | InChI=1S/C38H53N3O7/c1-3-5-20-31(43)39-26-30(27-16-10-8-11-17-27)47-37(46)32-29-21-22-38(48-29)33(32)35(44)41(24-14-6-7-15-25-42)34(38)36(45)40(23-4-2)28-18-12-9-13-19-28/h3-4,8,10-11,16-17,28-30,32-34,42H,1-2,5-7,9,12-15,18-26H2,(H,39,43)/t29-,30+,32+,33+,34-,38+/m1/s1 |
| InChIKey | SAOQZRKKDGMKSA-XAQCFCLQSA-N |
| XLogP | 4.63 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.86 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|