C15H20O4 — CID 23899972
(5-formyl-2,6,6-trimethylcyclohexa-2,4-dien-1-yl) (E)-4-hydroxy-3-methylbut-2-enoate (PubChem CID 23899972) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (5-formyl-2,6,6-trimethylcyclohexa-2,4-dien-1-yl) (E)-4-hydroxy-3-methylbut-2-enoate.
| Compound Name | (5-formyl-2,6,6-trimethylcyclohexa-2,4-dien-1-yl) (E)-4-hydroxy-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 23899972 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (5-formyl-2,6,6-trimethylcyclohexa-2,4-dien-1-yl) (E)-4-hydroxy-3-methylbut-2-enoate |
| SMILES | CC1=CC=C(C=O)C(C)(C)C1OC(=O)/C=C(\C)CO |
| InChI | InChI=1S/C15H20O4/c1-10(8-16)7-13(18)19-14-11(2)5-6-12(9-17)15(14,3)4/h5-7,9,14,16H,8H2,1-4H3/b10-7+ |
| InChIKey | OITVWQNYQGPKEG-JXMROGBWSA-N |
| XLogP | 1.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|