C31H18F12O4 — CID 23900018
[(4R,5R)-5-[hydroxy-bis(3,4,5-trifluorophenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(3,4,5-trifluorophenyl)methanol (PubChem CID 23900018) has the molecular formula C31H18F12O4 and a molecular weight of 682.46 g/mol. Its IUPAC name is [(4R,5R)-5-[hydroxy-bis(3,4,5-trifluorophenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(3,4,5-trifluorophenyl)methanol.
| Compound Name | [(4R,5R)-5-[hydroxy-bis(3,4,5-trifluorophenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(3,4,5-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 23900018 |
| Molecular Formula | C31H18F12O4 |
| Molecular Weight | 682.46 g/mol |
| Exact Mass | 682.10 |
| IUPAC Name | [(4R,5R)-5-[hydroxy-bis(3,4,5-trifluorophenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(3,4,5-trifluorophenyl)methanol |
| SMILES | CC1(C)O[C@@H](C(O)(c2cc(F)c(F)c(F)c2)c2cc(F)c(F)c(F)c2)[C@H](C(O)(c2cc(F)c(F)c(F)c2)c2cc(F)c(F)c(F)c2)O1 |
| InChI | InChI=1S/C31H18F12O4/c1-29(2)46-27(30(44,11-3-15(32)23(40)16(33)4-11)12-5-17(34)24(41)18(35)6-12)28(47-29)31(45,13-7-19(36)25(42)20(37)8-13)14-9-21(38)26(43)22(39)10-14/h3-10,27-28,44-45H,1-2H3/t27-,28-/m1/s1 |
| InChIKey | WSZACRWXCGMXJL-VSGBNLITSA-N |
| XLogP | 7.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.46 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|