C23H30FN5O5Si — CID 23900253
(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)spiro[1H-indole-3,2'-oxolane]-2-one (PubChem CID 23900253) has the molecular formula C23H30FN5O5Si and a molecular weight of 503.61 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)spiro[1H-indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)spiro[1H-indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23900253 |
| Molecular Formula | C23H30FN5O5Si |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)spiro[1H-indole-3,2'-oxolane]-2-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCn2cc(CCO)nn2)O[C@]12C(=O)Nc1ccc(N3CCOC3=O)cc12 |
| InChI | InChI=1S/C23H30FN5O5Si/c1-14-20(35(2,3)24)19(6-8-28-13-15(7-10-30)26-27-28)34-23(14)17-12-16(29-9-11-33-22(29)32)4-5-18(17)25-21(23)31/h4-5,12-14,19-20,30H,6-11H2,1-3H3,(H,25,31)/t14-,19+,20-,23+/m0/s1 |
| InChIKey | USTYJLJGQSJLLC-XAICUERPSA-N |
| XLogP | 2.59 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|