C17H28N4O3 — CID 2390057
(E)-N-cyclohexyl-3-[2-(2-oxo-2-piperidin-1-ylacetyl)hydrazinyl]but-2-enamide (PubChem CID 2390057) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is (E)-N-cyclohexyl-3-[2-(2-oxo-2-piperidin-1-ylacetyl)hydrazinyl]but-2-enamide.
| Compound Name | (E)-N-cyclohexyl-3-[2-(2-oxo-2-piperidin-1-ylacetyl)hydrazinyl]but-2-enamide |
|---|---|
| PubChem CID | 2390057 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (E)-N-cyclohexyl-3-[2-(2-oxo-2-piperidin-1-ylacetyl)hydrazinyl]but-2-enamide |
| SMILES | C/C(=C\C(=O)NC1CCCCC1)NNC(=O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H28N4O3/c1-13(12-15(22)18-14-8-4-2-5-9-14)19-20-16(23)17(24)21-10-6-3-7-11-21/h12,14,19H,2-11H2,1H3,(H,18,22)(H,20,23)/b13-12+ |
| InChIKey | OLBHRCXYIZBXEW-OUKQBFOZSA-N |
| XLogP | 0.97 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|