C29H40N8O3 — CID 23900838
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-[[4-(cyclopentylamino)-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 23900838) has the molecular formula C29H40N8O3 and a molecular weight of 548.69 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-[[4-(cyclopentylamino)-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-[[4-(cyclopentylamino)-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 23900838 |
| Molecular Formula | C29H40N8O3 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-[[4-(cyclopentylamino)-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | NCCOCCOCCNC(=O)c1cccc(Nc2nc(NCCc3ccccc3)nc(NC3CCCC3)n2)c1 |
| InChI | InChI=1S/C29H40N8O3/c30-14-17-39-19-20-40-18-16-31-26(38)23-9-6-12-25(21-23)34-29-36-27(32-15-13-22-7-2-1-3-8-22)35-28(37-29)33-24-10-4-5-11-24/h1-3,6-9,12,21,24H,4-5,10-11,13-20,30H2,(H,31,38)(H3,32,33,34,35,36,37) |
| InChIKey | IOWKRUCWJAWRPM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|