C24H30FN7O4 — CID 23901042
6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(1,3-benzodioxol-4-ylmethyl)-4-N-[(4-fluorophenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 23901042) has the molecular formula C24H30FN7O4 and a molecular weight of 499.55 g/mol. Its IUPAC name is 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(1,3-benzodioxol-4-ylmethyl)-4-N-[(4-fluorophenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(1,3-benzodioxol-4-ylmethyl)-4-N-[(4-fluorophenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23901042 |
| Molecular Formula | C24H30FN7O4 |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(1,3-benzodioxol-4-ylmethyl)-4-N-[(4-fluorophenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | NCCOCCOCCNc1nc(NCc2ccc(F)cc2)nc(NCc2cccc3c2OCO3)n1 |
| InChI | InChI=1S/C24H30FN7O4/c25-19-6-4-17(5-7-19)14-28-23-30-22(27-9-11-34-13-12-33-10-8-26)31-24(32-23)29-15-18-2-1-3-20-21(18)36-16-35-20/h1-7H,8-16,26H2,(H3,27,28,29,30,31,32) |
| InChIKey | ODRYOUDUIZEIRZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 137.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|