About 1,1-dibutylhydrazine
1,1-dibutylhydrazine (PubChem CID 23902) has the molecular formula C8H20N2
and a molecular weight of 144.26 g/mol. Its IUPAC name is 1,1-dibutylhydrazine.
Molecular Properties
| Compound Name | 1,1-dibutylhydrazine |
| PubChem CID | 23902 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | 1,1-dibutylhydrazine |
| SMILES | CCCCN(N)CCCC |
| InChI | InChI=1S/C8H20N2/c1-3-5-7-10(9)8-6-4-2/h3-9H2,1-2H3 |
| InChIKey | DJTIANXYHUNHQV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dibutylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibutylhydrazine?
The IUPAC name of 1,1-dibutylhydrazine (CID 23902) is 1,1-dibutylhydrazine.
What is the SMILES notation for 1,1-dibutylhydrazine?
The canonical SMILES for 1,1-dibutylhydrazine is CCCCN(N)CCCC.
What is the InChIKey of 1,1-dibutylhydrazine?
The InChIKey is DJTIANXYHUNHQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2/c1-3-5-7-10(9)8-6-4-2/h3-9H2,1-2H3.
What are the key properties of 1,1-dibutylhydrazine?
1,1-dibutylhydrazine has a molecular weight of 144.26 g/mol, XLogP of 1.76, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibutylhydrazine is sourced from PubChem (CID 23902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).