C34H36FIN2O4 — CID 23902538
(3R,3'S,4'S,5'R)-4'-(2-fluoropropan-2-yl)-5'-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-1-[(3-iodophenyl)methyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23902538) has the molecular formula C34H36FIN2O4 and a molecular weight of 682.57 g/mol. Its IUPAC name is (3R,3'S,4'S,5'R)-4'-(2-fluoropropan-2-yl)-5'-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-1-[(3-iodophenyl)methyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'S,4'S,5'R)-4'-(2-fluoropropan-2-yl)-5'-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-1-[(3-iodophenyl)methyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23902538 |
| Molecular Formula | C34H36FIN2O4 |
| Molecular Weight | 682.57 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | (3R,3'S,4'S,5'R)-4'-(2-fluoropropan-2-yl)-5'-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-1-[(3-iodophenyl)methyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@H]1[C@H](C(C)(C)F)[C@@H](CC(=O)N2Cc3ccccc3C[C@H]2CO)O[C@]12C(=O)N(Cc1cccc(I)c1)c1ccccc12 |
| InChI | InChI=1S/C34H36FIN2O4/c1-21-31(33(2,3)35)29(17-30(40)37-19-24-11-5-4-10-23(24)16-26(37)20-39)42-34(21)27-13-6-7-14-28(27)38(32(34)41)18-22-9-8-12-25(36)15-22/h4-15,21,26,29,31,39H,16-20H2,1-3H3/t21-,26-,29+,31-,34+/m0/s1 |
| InChIKey | CTBQAOWIBQNPJA-DAZWOGHOSA-N |
| XLogP | 5.77 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|