C18H20O5 — CID 23902718
(2R,4R)-4-(4-ethynylphenyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 23902718) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is (2R,4R)-4-(4-ethynylphenyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,4R)-4-(4-ethynylphenyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 23902718 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (2R,4R)-4-(4-ethynylphenyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | C#Cc1ccc([C@H]2C=C(C(=O)O)O[C@@H](OCCCCO)C2)cc1 |
| InChI | InChI=1S/C18H20O5/c1-2-13-5-7-14(8-6-13)15-11-16(18(20)21)23-17(12-15)22-10-4-3-9-19/h1,5-8,11,15,17,19H,3-4,9-10,12H2,(H,20,21)/t15-,17+/m0/s1 |
| InChIKey | BCVWLDHVDXAKCV-DOTOQJQBSA-N |
| XLogP | 2.26 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|