C19H23NO4 — CID 23902818
(2S,4S)-4-(4-ethynylphenyl)-2-(4-hydroxybutoxy)-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23902818) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2S,4S)-4-(4-ethynylphenyl)-2-(4-hydroxybutoxy)-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-4-(4-ethynylphenyl)-2-(4-hydroxybutoxy)-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23902818 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (2S,4S)-4-(4-ethynylphenyl)-2-(4-hydroxybutoxy)-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | C#Cc1ccc([C@@H]2C=C(C(=O)NC)O[C@H](OCCCCO)C2)cc1 |
| InChI | InChI=1S/C19H23NO4/c1-3-14-6-8-15(9-7-14)16-12-17(19(22)20-2)24-18(13-16)23-11-5-4-10-21/h1,6-9,12,16,18,21H,4-5,10-11,13H2,2H3,(H,20,22)/t16-,18+/m1/s1 |
| InChIKey | JHGMRXZCIWHQOD-AEFFLSMTSA-N |
| XLogP | 1.92 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|