C18H28O5 — CID 23902952
prop-2-enyl (2S,3R,4R)-4-cyclobutyl-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 23902952) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is prop-2-enyl (2S,3R,4R)-4-cyclobutyl-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | prop-2-enyl (2S,3R,4R)-4-cyclobutyl-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 23902952 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | prop-2-enyl (2S,3R,4R)-4-cyclobutyl-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C[C@@H](C2CCC2)[C@@H](CCCO)[C@@H](OCC)O1 |
| InChI | InChI=1S/C18H28O5/c1-3-11-22-17(20)16-12-15(13-7-5-8-13)14(9-6-10-19)18(23-16)21-4-2/h3,12-15,18-19H,1,4-11H2,2H3/t14-,15+,18+/m1/s1 |
| InChIKey | MDXBCZGBDHSYFS-VKJFTORMSA-N |
| XLogP | 2.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|