C25H29F3N4O6 — CID 23902964
(2S,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23902964) has the molecular formula C25H29F3N4O6 and a molecular weight of 538.52 g/mol. Its IUPAC name is (2S,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23902964 |
| Molecular Formula | C25H29F3N4O6 |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | (2S,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@H]1OC(C(=O)NCCNc2ccc([N+](=O)[O-])cn2)=C[C@@H](c2ccc(C(F)(F)F)cc2)[C@H]1CCCO |
| InChI | InChI=1S/C25H29F3N4O6/c1-2-37-24-19(4-3-13-33)20(16-5-7-17(8-6-16)25(26,27)28)14-21(38-24)23(34)30-12-11-29-22-10-9-18(15-31-22)32(35)36/h5-10,14-15,19-20,24,33H,2-4,11-13H2,1H3,(H,29,31)(H,30,34)/t19-,20+,24+/m1/s1 |
| InChIKey | YMTYTKBHMIXWTN-NMMYMHLASA-N |
| XLogP | 3.99 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|