C16H15N3O — CID 2390471
(Z)-3-(1H-indol-3-yl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile (PubChem CID 2390471) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is (Z)-3-(1H-indol-3-yl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(1H-indol-3-yl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2390471 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (Z)-3-(1H-indol-3-yl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1c[nH]c2ccccc12)C(=O)N1CCCC1 |
| InChI | InChI=1S/C16H15N3O/c17-10-12(16(20)19-7-3-4-8-19)9-13-11-18-15-6-2-1-5-14(13)15/h1-2,5-6,9,11,18H,3-4,7-8H2/b12-9- |
| InChIKey | ZPIHWBMFVOBODQ-XFXZXTDPSA-N |
| XLogP | 2.70 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|