C20H20N2O6S2 — CID 2390489
N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 2390489) has the molecular formula C20H20N2O6S2 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2390489 |
| Molecular Formula | C20H20N2O6S2 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCN2C(=O)S/C(=C\c3cccs3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H20N2O6S2/c1-26-14-9-12(10-15(27-2)17(14)28-3)18(23)21-6-7-22-19(24)16(30-20(22)25)11-13-5-4-8-29-13/h4-5,8-11H,6-7H2,1-3H3,(H,21,23)/b16-11- |
| InChIKey | UWMWBBHMRHYRCQ-WJDWOHSUSA-N |
| XLogP | 3.24 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|