C26H25Cl2N3O4 — CID 23905744
(4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 23905744) has the molecular formula C26H25Cl2N3O4 and a molecular weight of 514.41 g/mol. Its IUPAC name is (4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 23905744 |
| Molecular Formula | C26H25Cl2N3O4 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | (4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | CC(C)Oc1ccc(/C(O)=C2/C(=O)C(=O)N(CCCn3ccnc3)C2c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C26H25Cl2N3O4/c1-16(2)35-19-7-4-17(5-8-19)24(32)22-23(18-6-9-20(27)21(28)14-18)31(26(34)25(22)33)12-3-11-30-13-10-29-15-30/h4-10,13-16,23,32H,3,11-12H2,1-2H3/b24-22- |
| InChIKey | QYSAWVNAYLDBQM-GYHWCHFESA-N |
| XLogP | 5.49 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|