About 2-ethylhexyl 2-ethylhexanoate
2-ethylhexyl 2-ethylhexanoate (PubChem CID 23906) has the molecular formula C16H32O2
and a molecular weight of 256.43 g/mol. Its IUPAC name is 2-ethylhexyl 2-ethylhexanoate.
Molecular Properties
| Compound Name | 2-ethylhexyl 2-ethylhexanoate |
| PubChem CID | 23906 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 2-ethylhexyl 2-ethylhexanoate |
| SMILES | CCCCC(CC)COC(=O)C(CC)CCCC |
| InChI | InChI=1S/C16H32O2/c1-5-9-11-14(7-3)13-18-16(17)15(8-4)12-10-6-2/h14-15H,5-13H2,1-4H3 |
| InChIKey | OUCGJMIVSYHBEC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylhexyl 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 2-ethylhexanoate?
The IUPAC name of 2-ethylhexyl 2-ethylhexanoate (CID 23906) is 2-ethylhexyl 2-ethylhexanoate.
What is the SMILES notation for 2-ethylhexyl 2-ethylhexanoate?
The canonical SMILES for 2-ethylhexyl 2-ethylhexanoate is CCCCC(CC)COC(=O)C(CC)CCCC.
What is the InChIKey of 2-ethylhexyl 2-ethylhexanoate?
The InChIKey is OUCGJMIVSYHBEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2/c1-5-9-11-14(7-3)13-18-16(17)15(8-4)12-10-6-2/h14-15H,5-13H2,1-4H3.
What are the key properties of 2-ethylhexyl 2-ethylhexanoate?
2-ethylhexyl 2-ethylhexanoate has a molecular weight of 256.43 g/mol, XLogP of 4.96, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 2-ethylhexanoate is sourced from PubChem (CID 23906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).