C13H13N3OS — CID 23907587
4,11,12,13-tetramethyl-8-thia-3,6,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-one (PubChem CID 23907587) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 4,11,12,13-tetramethyl-8-thia-3,6,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-one.
| Compound Name | 4,11,12,13-tetramethyl-8-thia-3,6,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-one |
|---|---|
| PubChem CID | 23907587 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4,11,12,13-tetramethyl-8-thia-3,6,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-one |
| SMILES | Cc1nc2sc3[nH]c(=O)c(C)nc3c2c(C)c1C |
| InChI | InChI=1S/C13H13N3OS/c1-5-6(2)9-10-13(16-11(17)8(4)14-10)18-12(9)15-7(5)3/h1-4H3,(H,16,17) |
| InChIKey | BSMPOPLDHCPTNF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |