C20H22N2O6 — CID 23908070
5-O-ethyl 3-O-methyl 2-amino-3'-oxo-6-propylspiro[1H-pyridine-4,1'-2-benzofuran]-3,5-dicarboxylate (PubChem CID 23908070) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 2-amino-3'-oxo-6-propylspiro[1H-pyridine-4,1'-2-benzofuran]-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 2-amino-3'-oxo-6-propylspiro[1H-pyridine-4,1'-2-benzofuran]-3,5-dicarboxylate |
|---|---|
| PubChem CID | 23908070 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 2-amino-3'-oxo-6-propylspiro[1H-pyridine-4,1'-2-benzofuran]-3,5-dicarboxylate |
| SMILES | CCCC1=C(C(=O)OCC)C2(OC(=O)c3ccccc32)C(C(=O)OC)=C(N)N1 |
| InChI | InChI=1S/C20H22N2O6/c1-4-8-13-14(19(25)27-5-2)20(15(16(21)22-13)18(24)26-3)12-10-7-6-9-11(12)17(23)28-20/h6-7,9-10,22H,4-5,8,21H2,1-3H3 |
| InChIKey | AHZACEMMMQSDTG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|