About [6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate
[6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate (PubChem CID 23908515) has the molecular formula C15H14ClN5O2
and a molecular weight of 331.76 g/mol. Its IUPAC name is [6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate.
Molecular Properties
| Compound Name | [6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate |
| PubChem CID | 23908515 |
| Molecular Formula | C15H14ClN5O2 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | [6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate |
| SMILES | CC(=O)OCc1nn(C)c2nc(N)c(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C15H14ClN5O2/c1-8(22)23-7-11-13-15(21(2)20-11)19-14(17)12(18-13)9-3-5-10(16)6-4-9/h3-6H,7H2,1-2H3,(H2,17,19) |
| InChIKey | SNFJOCFHOFJBBZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate?
The IUPAC name of [6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate (CID 23908515) is [6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate.
What is the SMILES notation for [6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate?
The canonical SMILES for [6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate is CC(=O)OCc1nn(C)c2nc(N)c(-c3ccc(Cl)cc3)nc12.
What is the InChIKey of [6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate?
The InChIKey is SNFJOCFHOFJBBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClN5O2/c1-8(22)23-7-11-13-15(21(2)20-11)19-14(17)12(18-13)9-3-5-10(16)6-4-9/h3-6H,7H2,1-2H3,(H2,17,19).
What are the key properties of [6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate?
[6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate has a molecular weight of 331.76 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-amino-5-(4-chlorophenyl)-1-methylpyrazolo[4,5-b]pyrazin-3-yl]methyl acetate is sourced from PubChem (CID 23908515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).