C22H27N3S — CID 23909945
N-(3,4-dimethylphenyl)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbothioamide (PubChem CID 23909945) has the molecular formula C22H27N3S and a molecular weight of 365.55 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbothioamide.
| Compound Name | N-(3,4-dimethylphenyl)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbothioamide |
|---|---|
| PubChem CID | 23909945 |
| Molecular Formula | C22H27N3S |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbothioamide |
| SMILES | Cc1ccc2c(c1)C1CN(C)CCC1N2C(=S)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C22H27N3S/c1-14-5-8-20-18(11-14)19-13-24(4)10-9-21(19)25(20)22(26)23-17-7-6-15(2)16(3)12-17/h5-8,11-12,19,21H,9-10,13H2,1-4H3,(H,23,26) |
| InChIKey | SIDIMECMSWZOTL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|