About 7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one
7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one (PubChem CID 23910904) has the molecular formula C16H17ClO3
and a molecular weight of 292.76 g/mol. Its IUPAC name is 7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one.
Molecular Properties
| Compound Name | 7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one |
| PubChem CID | 23910904 |
| Molecular Formula | C16H17ClO3 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one |
| SMILES | CCCOc1cc2oc3c(c(=O)c2cc1Cl)CCCC3 |
| InChI | InChI=1S/C16H17ClO3/c1-2-7-19-15-9-14-11(8-12(15)17)16(18)10-5-3-4-6-13(10)20-14/h8-9H,2-7H2,1H3 |
| InChIKey | PCYXEXAVIHBGSN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one?
The IUPAC name of 7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one (CID 23910904) is 7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one.
What is the SMILES notation for 7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one?
The canonical SMILES for 7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one is CCCOc1cc2oc3c(c(=O)c2cc1Cl)CCCC3.
What is the InChIKey of 7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one?
The InChIKey is PCYXEXAVIHBGSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClO3/c1-2-7-19-15-9-14-11(8-12(15)17)16(18)10-5-3-4-6-13(10)20-14/h8-9H,2-7H2,1H3.
What are the key properties of 7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one?
7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one has a molecular weight of 292.76 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-6-propoxy-1,2,3,4-tetrahydroxanthen-9-one is sourced from PubChem (CID 23910904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).