C29H28N4O2 — CID 23910969
N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-N-naphthalen-1-ylpyrazine-2-carboxamide (PubChem CID 23910969) has the molecular formula C29H28N4O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-N-naphthalen-1-ylpyrazine-2-carboxamide.
| Compound Name | N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-N-naphthalen-1-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 23910969 |
| Molecular Formula | C29H28N4O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-N-naphthalen-1-ylpyrazine-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)C(c1ccccc1)N(C(=O)c1cnccn1)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H28N4O2/c34-28(32-23-14-5-2-6-15-23)27(22-11-3-1-4-12-22)33(29(35)25-20-30-18-19-31-25)26-17-9-13-21-10-7-8-16-24(21)26/h1,3-4,7-13,16-20,23,27H,2,5-6,14-15H2,(H,32,34) |
| InChIKey | ODEVQXRTPAPLOF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |