C23H26N4O3 — CID 23911248
N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1-(2,4,5-trimethoxyphenyl)methanimine (PubChem CID 23911248) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1-(2,4,5-trimethoxyphenyl)methanimine.
| Compound Name | N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1-(2,4,5-trimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 23911248 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1-(2,4,5-trimethoxyphenyl)methanimine |
| SMILES | COc1cc(OC)c(OC)cc1/C=N/c1ccc(-c2nnc3n2CCCCC3)cc1 |
| InChI | InChI=1S/C23H26N4O3/c1-28-19-14-21(30-3)20(29-2)13-17(19)15-24-18-10-8-16(9-11-18)23-26-25-22-7-5-4-6-12-27(22)23/h8-11,13-15H,4-7,12H2,1-3H3/b24-15+ |
| InChIKey | PZHXHKRHLRGURV-BUVRLJJBSA-N |
| XLogP | 4.45 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|