C25H39NO2 — CID 23911344
[(1S,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 23911344) has the molecular formula C25H39NO2 and a molecular weight of 385.59 g/mol. Its IUPAC name is [(1S,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | [(1S,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 23911344 |
| Molecular Formula | C25H39NO2 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | [(1S,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | CC(C)C1=CC2=CCC3[C@@](C)(CCC[C@]3(C)C(=O)N3CCC(O)CC3)C2CC1 |
| InChI | InChI=1S/C25H39NO2/c1-17(2)18-6-8-21-19(16-18)7-9-22-24(21,3)12-5-13-25(22,4)23(28)26-14-10-20(27)11-15-26/h7,16-17,20-22,27H,5-6,8-15H2,1-4H3/t21?,22?,24-,25-/m0/s1 |
| InChIKey | TVMDRNSJDQAOGW-OPWKESLNSA-N |
| XLogP | 5.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |