C18H8N4OS — CID 23911807
2-oxo-10-thia-3,14,21-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),4,6,8,11,13,15,17,19-nonaene-12-carbonitrile (PubChem CID 23911807) has the molecular formula C18H8N4OS and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-oxo-10-thia-3,14,21-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),4,6,8,11,13,15,17,19-nonaene-12-carbonitrile.
| Compound Name | 2-oxo-10-thia-3,14,21-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),4,6,8,11,13,15,17,19-nonaene-12-carbonitrile |
|---|---|
| PubChem CID | 23911807 |
| Molecular Formula | C18H8N4OS |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-oxo-10-thia-3,14,21-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),4,6,8,11,13,15,17,19-nonaene-12-carbonitrile |
| SMILES | N#Cc1c2nc3ccccc3nc2c(=O)n2c1sc1ccccc12 |
| InChI | InChI=1S/C18H8N4OS/c19-9-10-15-16(21-12-6-2-1-5-11(12)20-15)17(23)22-13-7-3-4-8-14(13)24-18(10)22/h1-8H |
| InChIKey | AJSBEBXIWNASRF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|