C26H22FN3O2S — CID 23911952
3-(2,3-dihydroinden-1-ylideneamino)-4-(2,5-dimethoxyphenyl)-N-(4-fluorophenyl)-1,3-thiazol-2-imine (PubChem CID 23911952) has the molecular formula C26H22FN3O2S and a molecular weight of 459.55 g/mol. Its IUPAC name is 3-(2,3-dihydroinden-1-ylideneamino)-4-(2,5-dimethoxyphenyl)-N-(4-fluorophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(2,3-dihydroinden-1-ylideneamino)-4-(2,5-dimethoxyphenyl)-N-(4-fluorophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23911952 |
| Molecular Formula | C26H22FN3O2S |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 3-(2,3-dihydroinden-1-ylideneamino)-4-(2,5-dimethoxyphenyl)-N-(4-fluorophenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(OC)c(-c2cs/c(=N\c3ccc(F)cc3)n2N=C2CCc3ccccc32)c1 |
| InChI | InChI=1S/C26H22FN3O2S/c1-31-20-12-14-25(32-2)22(15-20)24-16-33-26(28-19-10-8-18(27)9-11-19)30(24)29-23-13-7-17-5-3-4-6-21(17)23/h3-6,8-12,14-16H,7,13H2,1-2H3/b28-26-,29-23? |
| InChIKey | DGYOUOPXTTVNQG-HPNMDMAKSA-N |
| XLogP | 5.80 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|