C31H38N4O3S — CID 23911989
N-(4,5-dimethyl-2-nitrophenyl)-4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidine-1-carboxamide (PubChem CID 23911989) has the molecular formula C31H38N4O3S and a molecular weight of 546.74 g/mol. Its IUPAC name is N-(4,5-dimethyl-2-nitrophenyl)-4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidine-1-carboxamide.
| Compound Name | N-(4,5-dimethyl-2-nitrophenyl)-4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 23911989 |
| Molecular Formula | C31H38N4O3S |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | N-(4,5-dimethyl-2-nitrophenyl)-4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidine-1-carboxamide |
| SMILES | Cc1cc(NC(=O)N2CCC(c3nc(-c4ccc5c(c4)C(C)(C)CCC5(C)C)cs3)CC2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C31H38N4O3S/c1-19-15-25(27(35(37)38)16-20(19)2)33-29(36)34-13-9-21(10-14-34)28-32-26(18-39-28)22-7-8-23-24(17-22)31(5,6)12-11-30(23,3)4/h7-8,15-18,21H,9-14H2,1-6H3,(H,33,36) |
| InChIKey | LFRBCNJZEVIWDO-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|