C17H20N4O3S — CID 23913587
ethyl 4-amino-2-[3-(3-methylanilino)-3-oxopropyl]sulfanylpyrimidine-5-carboxylate (PubChem CID 23913587) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is ethyl 4-amino-2-[3-(3-methylanilino)-3-oxopropyl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[3-(3-methylanilino)-3-oxopropyl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 23913587 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | ethyl 4-amino-2-[3-(3-methylanilino)-3-oxopropyl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCCC(=O)Nc2cccc(C)c2)nc1N |
| InChI | InChI=1S/C17H20N4O3S/c1-3-24-16(23)13-10-19-17(21-15(13)18)25-8-7-14(22)20-12-6-4-5-11(2)9-12/h4-6,9-10H,3,7-8H2,1-2H3,(H,20,22)(H2,18,19,21) |
| InChIKey | MJTSWGRIYYJSQN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |