C16H17N5OS — CID 23913595
N-(2,4-dimethylphenyl)-2-(2H-tetrazol-5-yl)-3-thiophen-2-ylpropanamide (PubChem CID 23913595) has the molecular formula C16H17N5OS and a molecular weight of 327.41 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-(2H-tetrazol-5-yl)-3-thiophen-2-ylpropanamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-(2H-tetrazol-5-yl)-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 23913595 |
| Molecular Formula | C16H17N5OS |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-(2H-tetrazol-5-yl)-3-thiophen-2-ylpropanamide |
| SMILES | Cc1ccc(NC(=O)C(Cc2cccs2)c2nn[nH]n2)c(C)c1 |
| InChI | InChI=1S/C16H17N5OS/c1-10-5-6-14(11(2)8-10)17-16(22)13(15-18-20-21-19-15)9-12-4-3-7-23-12/h3-8,13H,9H2,1-2H3,(H,17,22)(H,18,19,20,21) |
| InChIKey | CHYWBBIJSMHCBZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |