About 1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea
1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea (PubChem CID 23913689) has the molecular formula C22H24ClN3O
and a molecular weight of 381.91 g/mol. Its IUPAC name is 1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea.
Molecular Properties
| Compound Name | 1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea |
| PubChem CID | 23913689 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea |
| SMILES | Cc1cc(C)c2nc(Cl)c(CN(Cc3ccccc3)C(=O)N(C)C)cc2c1 |
| InChI | InChI=1S/C22H24ClN3O/c1-15-10-16(2)20-18(11-15)12-19(21(23)24-20)14-26(22(27)25(3)4)13-17-8-6-5-7-9-17/h5-12H,13-14H2,1-4H3 |
| InChIKey | ZFELOXGZAOQEHE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea?
The IUPAC name of 1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea (CID 23913689) is 1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea.
What is the SMILES notation for 1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea?
The canonical SMILES for 1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea is Cc1cc(C)c2nc(Cl)c(CN(Cc3ccccc3)C(=O)N(C)C)cc2c1.
What is the InChIKey of 1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea?
The InChIKey is ZFELOXGZAOQEHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24ClN3O/c1-15-10-16(2)20-18(11-15)12-19(21(23)24-20)14-26(22(27)25(3)4)13-17-8-6-5-7-9-17/h5-12H,13-14H2,1-4H3.
What are the key properties of 1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea?
1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea has a molecular weight of 381.91 g/mol, XLogP of 5.19, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,3-dimethylurea is sourced from PubChem (CID 23913689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).