C31H24N4OS — CID 23915552
1-carbazol-9-yl-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]butan-1-one (PubChem CID 23915552) has the molecular formula C31H24N4OS and a molecular weight of 500.63 g/mol. Its IUPAC name is 1-carbazol-9-yl-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]butan-1-one.
| Compound Name | 1-carbazol-9-yl-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 23915552 |
| Molecular Formula | C31H24N4OS |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 1-carbazol-9-yl-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]butan-1-one |
| SMILES | CCC(Sc1nnc(-c2ccccc2)c(-c2ccccc2)n1)C(=O)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C31H24N4OS/c1-2-27(30(36)35-25-19-11-9-17-23(25)24-18-10-12-20-26(24)35)37-31-32-28(21-13-5-3-6-14-21)29(33-34-31)22-15-7-4-8-16-22/h3-20,27H,2H2,1H3 |
| InChIKey | QZMGDCJKWSYMLV-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |