C26H19N3O6 — CID 23915622
[2-(2-methoxyanilino)-2-oxoethyl] 2,3-bis(furan-2-yl)quinoxaline-6-carboxylate (PubChem CID 23915622) has the molecular formula C26H19N3O6 and a molecular weight of 469.45 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl] 2,3-bis(furan-2-yl)quinoxaline-6-carboxylate.
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl] 2,3-bis(furan-2-yl)quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 23915622 |
| Molecular Formula | C26H19N3O6 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl] 2,3-bis(furan-2-yl)quinoxaline-6-carboxylate |
| SMILES | COc1ccccc1NC(=O)COC(=O)c1ccc2nc(-c3ccco3)c(-c3ccco3)nc2c1 |
| InChI | InChI=1S/C26H19N3O6/c1-32-20-7-3-2-6-18(20)27-23(30)15-35-26(31)16-10-11-17-19(14-16)29-25(22-9-5-13-34-22)24(28-17)21-8-4-12-33-21/h2-14H,15H2,1H3,(H,27,30) |
| InChIKey | FGVPGQNNVJWSLY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |