About 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide
3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide (PubChem CID 23917257) has the molecular formula C28H23N3OS
and a molecular weight of 449.58 g/mol. Its IUPAC name is 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide.
Molecular Properties
| Compound Name | 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide |
| PubChem CID | 23917257 |
| Molecular Formula | C28H23N3OS |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)CCSc2nc(-c3ccccc3)cc(-c3ccccc3)c2C#N)c1 |
| InChI | InChI=1S/C28H23N3OS/c1-20-9-8-14-23(17-20)30-27(32)15-16-33-28-25(19-29)24(21-10-4-2-5-11-21)18-26(31-28)22-12-6-3-7-13-22/h2-14,17-18H,15-16H2,1H3,(H,30,32) |
| InChIKey | JAACIJHWVYXYDP-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide?
The IUPAC name of 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide (CID 23917257) is 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide.
What is the SMILES notation for 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide?
The canonical SMILES for 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide is Cc1cccc(NC(=O)CCSc2nc(-c3ccccc3)cc(-c3ccccc3)c2C#N)c1.
What is the InChIKey of 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide?
The InChIKey is JAACIJHWVYXYDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H23N3OS/c1-20-9-8-14-23(17-20)30-27(32)15-16-33-28-25(19-29)24(21-10-4-2-5-11-21)18-26(31-28)22-12-6-3-7-13-22/h2-14,17-18H,15-16H2,1H3,(H,30,32).
What are the key properties of 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide?
3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide has a molecular weight of 449.58 g/mol, XLogP of 6.72, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)propanamide is sourced from PubChem (CID 23917257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).