C28H28FN3O9 — CID 23919059
[(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(phenylcarbamoyloxy)oxan-3-yl] N-(3-fluorophenyl)carbamate (PubChem CID 23919059) has the molecular formula C28H28FN3O9 and a molecular weight of 569.54 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(phenylcarbamoyloxy)oxan-3-yl] N-(3-fluorophenyl)carbamate.
| Compound Name | [(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(phenylcarbamoyloxy)oxan-3-yl] N-(3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 23919059 |
| Molecular Formula | C28H28FN3O9 |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(phenylcarbamoyloxy)oxan-3-yl] N-(3-fluorophenyl)carbamate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](OC(=O)Nc2cccc(F)c2)[C@H](OC(=O)Nc2ccccc2)[C@H]1OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H28FN3O9/c1-37-25-24(41-27(35)31-19-12-6-3-7-13-19)23(40-26(34)30-18-10-4-2-5-11-18)22(21(16-33)38-25)39-28(36)32-20-14-8-9-17(29)15-20/h2-15,21-25,33H,16H2,1H3,(H,30,34)(H,31,35)(H,32,36)/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | OAICBADFGHURIF-RXFVIIJJSA-N |
| XLogP | 4.34 |
| TPSA | 153.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|