C30H34BrN3O4 — CID 23919174
(4S,5S)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-N'-[2-(4-methylphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23919174) has the molecular formula C30H34BrN3O4 and a molecular weight of 580.52 g/mol. Its IUPAC name is (4S,5S)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-N'-[2-(4-methylphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-N'-[2-(4-methylphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23919174 |
| Molecular Formula | C30H34BrN3O4 |
| Molecular Weight | 580.52 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | (4S,5S)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-N'-[2-(4-methylphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | Cc1ccc(CCNNC(=O)[C@@]2(Cc3ccc(Br)cc3)N=C(c3ccc(OCCCO)cc3)O[C@H]2C)cc1 |
| InChI | InChI=1S/C30H34BrN3O4/c1-21-4-6-23(7-5-21)16-17-32-34-29(36)30(20-24-8-12-26(31)13-9-24)22(2)38-28(33-30)25-10-14-27(15-11-25)37-19-3-18-35/h4-15,22,32,35H,3,16-20H2,1-2H3,(H,34,36)/t22-,30-/m0/s1 |
| InChIKey | SZQNMXJNUJCEQU-CHJDUVSTSA-N |
| XLogP | 4.53 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|