C35H33F2N3O4 — CID 23919317
(4S,5S)-N'-[(3,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23919317) has the molecular formula C35H33F2N3O4 and a molecular weight of 597.66 g/mol. Its IUPAC name is (4S,5S)-N'-[(3,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-N'-[(3,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23919317 |
| Molecular Formula | C35H33F2N3O4 |
| Molecular Weight | 597.66 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | (4S,5S)-N'-[(3,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | C=CC[C@]1(C(=O)NNCc2ccc(F)c(F)c2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H33F2N3O4/c1-2-19-35(34(42)40-38-23-24-9-18-30(36)31(37)22-24)32(27-12-10-26(11-13-27)25-7-4-3-5-8-25)44-33(39-35)28-14-16-29(17-15-28)43-21-6-20-41/h2-5,7-18,22,32,38,41H,1,6,19-21,23H2,(H,40,42)/t32-,35-/m0/s1 |
| InChIKey | MHBHVTCIUCYTNZ-SHUZPENHSA-N |
| XLogP | 6.05 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|